C26H42O4S — CID 142135459
3-benzyl-8-(7-carboxy-6,6-dimethylheptyl)sulfanyl-3-methyloctanoic acid (PubChem CID 142135459) has the molecular formula C26H42O4S and a molecular weight of 450.69 g/mol. Its IUPAC name is 3-benzyl-8-(7-carboxy-6,6-dimethylheptyl)sulfanyl-3-methyloctanoic acid.
| Compound Name | 3-benzyl-8-(7-carboxy-6,6-dimethylheptyl)sulfanyl-3-methyloctanoic acid |
|---|---|
| PubChem CID | 142135459 |
| Molecular Formula | C26H42O4S |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 3-benzyl-8-(7-carboxy-6,6-dimethylheptyl)sulfanyl-3-methyloctanoic acid |
| SMILES | CC(C)(CCCCCSCCCCCC(C)(CC(=O)O)Cc1ccccc1)CC(=O)O |
| InChI | InChI=1S/C26H42O4S/c1-25(2,20-23(27)28)15-9-5-11-17-31-18-12-6-10-16-26(3,21-24(29)30)19-22-13-7-4-8-14-22/h4,7-8,13-14H,5-6,9-12,15-21H2,1-3H3,(H,27,28)(H,29,30) |
| InChIKey | LGBFTLJEMYMDMQ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|