C29H42O2S — CID 143048145
3-methyl-8-(6-methyl-6-phenylheptyl)sulfanyl-3-phenyloctanoic acid (PubChem CID 143048145) has the molecular formula C29H42O2S and a molecular weight of 454.72 g/mol. Its IUPAC name is 3-methyl-8-(6-methyl-6-phenylheptyl)sulfanyl-3-phenyloctanoic acid.
| Compound Name | 3-methyl-8-(6-methyl-6-phenylheptyl)sulfanyl-3-phenyloctanoic acid |
|---|---|
| PubChem CID | 143048145 |
| Molecular Formula | C29H42O2S |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 3-methyl-8-(6-methyl-6-phenylheptyl)sulfanyl-3-phenyloctanoic acid |
| SMILES | CC(C)(CCCCCSCCCCCC(C)(CC(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H42O2S/c1-28(2,25-16-8-4-9-17-25)20-12-6-14-22-32-23-15-7-13-21-29(3,24-27(30)31)26-18-10-5-11-19-26/h4-5,8-11,16-19H,6-7,12-15,20-24H2,1-3H3,(H,30,31) |
| InChIKey | FIUZKJCJNPFWSL-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|