C28H38O5S — CID 18752548
7-(6-carboxy-5-methyl-5-phenylhexyl)sulfinyl-3-methyl-3-phenylheptanoic acid (PubChem CID 18752548) has the molecular formula C28H38O5S and a molecular weight of 486.67 g/mol. Its IUPAC name is 7-(6-carboxy-5-methyl-5-phenylhexyl)sulfinyl-3-methyl-3-phenylheptanoic acid.
| Compound Name | 7-(6-carboxy-5-methyl-5-phenylhexyl)sulfinyl-3-methyl-3-phenylheptanoic acid |
|---|---|
| PubChem CID | 18752548 |
| Molecular Formula | C28H38O5S |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 7-(6-carboxy-5-methyl-5-phenylhexyl)sulfinyl-3-methyl-3-phenylheptanoic acid |
| SMILES | CC(CCCCS(=O)CCCCC(C)(CC(=O)O)c1ccccc1)(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C28H38O5S/c1-27(21-25(29)30,23-13-5-3-6-14-23)17-9-11-19-34(33)20-12-10-18-28(2,22-26(31)32)24-15-7-4-8-16-24/h3-8,13-16H,9-12,17-22H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | NYLYZGISKJYBHG-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|