C28H38O5 — CID 143079797
3-methyl-7-oxo-3-phenylheptanoic acid;3-methyl-3-phenylheptanoic acid (PubChem CID 143079797) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 3-methyl-7-oxo-3-phenylheptanoic acid;3-methyl-3-phenylheptanoic acid.
| Compound Name | 3-methyl-7-oxo-3-phenylheptanoic acid;3-methyl-3-phenylheptanoic acid |
|---|---|
| PubChem CID | 143079797 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 3-methyl-7-oxo-3-phenylheptanoic acid;3-methyl-3-phenylheptanoic acid |
| SMILES | CC(CCCC=O)(CC(=O)O)c1ccccc1.CCCCC(C)(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H18O3.C14H20O2/c1-14(11-13(16)17,9-5-6-10-15)12-7-3-2-4-8-12;1-3-4-10-14(2,11-13(15)16)12-8-6-5-7-9-12/h2-4,7-8,10H,5-6,9,11H2,1H3,(H,16,17);5-9H,3-4,10-11H2,1-2H3,(H,15,16) |
| InChIKey | KALHMTZLNJXSAJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|