C27H38O3 — CID 130256585
(3R)-9-hydroxy-3-methyl-3,14-diphenyltetradecanoic acid (PubChem CID 130256585) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is (3R)-9-hydroxy-3-methyl-3,14-diphenyltetradecanoic acid.
| Compound Name | (3R)-9-hydroxy-3-methyl-3,14-diphenyltetradecanoic acid |
|---|---|
| PubChem CID | 130256585 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | (3R)-9-hydroxy-3-methyl-3,14-diphenyltetradecanoic acid |
| SMILES | C[C@@](CCCCCC(O)CCCCCc1ccccc1)(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C27H38O3/c1-27(22-26(29)30,24-17-9-4-10-18-24)21-13-5-12-20-25(28)19-11-3-8-16-23-14-6-2-7-15-23/h2,4,6-7,9-10,14-15,17-18,25,28H,3,5,8,11-13,16,19-22H2,1H3,(H,29,30)/t25?,27-/m1/s1 |
| InChIKey | OUSIXBSEDUPFAG-ZCJYOONXSA-N |
| XLogP | 6.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|