C29H44O3 — CID 59660113
3,13-dimethyl-3,13-diphenylpentadecane-1,8,15-triol (PubChem CID 59660113) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is 3,13-dimethyl-3,13-diphenylpentadecane-1,8,15-triol.
| Compound Name | 3,13-dimethyl-3,13-diphenylpentadecane-1,8,15-triol |
|---|---|
| PubChem CID | 59660113 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 3,13-dimethyl-3,13-diphenylpentadecane-1,8,15-triol |
| SMILES | CC(CCO)(CCCCC(O)CCCCC(C)(CCO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H44O3/c1-28(21-23-30,25-13-5-3-6-14-25)19-11-9-17-27(32)18-10-12-20-29(2,22-24-31)26-15-7-4-8-16-26/h3-8,13-16,27,30-32H,9-12,17-24H2,1-2H3 |
| InChIKey | UBFQJLOLRVBRLK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|