C27H42O9P2 — CID 59660096
(8-hydroxy-2,14-diphenyl-14-phosphonooxypentadecan-2-yl) dihydrogen phosphate (PubChem CID 59660096) has the molecular formula C27H42O9P2 and a molecular weight of 572.57 g/mol. Its IUPAC name is (8-hydroxy-2,14-diphenyl-14-phosphonooxypentadecan-2-yl) dihydrogen phosphate.
| Compound Name | (8-hydroxy-2,14-diphenyl-14-phosphonooxypentadecan-2-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 59660096 |
| Molecular Formula | C27H42O9P2 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | (8-hydroxy-2,14-diphenyl-14-phosphonooxypentadecan-2-yl) dihydrogen phosphate |
| SMILES | CC(CCCCCC(O)CCCCCC(C)(OP(=O)(O)O)c1ccccc1)(OP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C27H42O9P2/c1-26(35-37(29,30)31,23-15-7-3-8-16-23)21-13-5-11-19-25(28)20-12-6-14-22-27(2,36-38(32,33)34)24-17-9-4-10-18-24/h3-4,7-10,15-18,25,28H,5-6,11-14,19-22H2,1-2H3,(H2,29,30,31)(H2,32,33,34) |
| InChIKey | AINHEJFJJCVWON-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|