C31H48O3 — CID 70661516
16-methoxy-3,15-dimethyl-3,15-diphenylhexadecane-1,9-diol (PubChem CID 70661516) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is 16-methoxy-3,15-dimethyl-3,15-diphenylhexadecane-1,9-diol.
| Compound Name | 16-methoxy-3,15-dimethyl-3,15-diphenylhexadecane-1,9-diol |
|---|---|
| PubChem CID | 70661516 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | 16-methoxy-3,15-dimethyl-3,15-diphenylhexadecane-1,9-diol |
| SMILES | COCC(C)(CCCCCC(O)CCCCCC(C)(CCO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H48O3/c1-30(24-25-32,27-16-8-4-9-17-27)22-14-6-12-20-29(33)21-13-7-15-23-31(2,26-34-3)28-18-10-5-11-19-28/h4-5,8-11,16-19,29,32-33H,6-7,12-15,20-26H2,1-3H3 |
| InChIKey | DVWYOYCBTLTIRV-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|