C31H46O2 — CID 58097515
3,13-dimethyl-2-methylidene-3,13-diphenylhexadecane-1,8-diol (PubChem CID 58097515) has the molecular formula C31H46O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 3,13-dimethyl-2-methylidene-3,13-diphenylhexadecane-1,8-diol.
| Compound Name | 3,13-dimethyl-2-methylidene-3,13-diphenylhexadecane-1,8-diol |
|---|---|
| PubChem CID | 58097515 |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | 3,13-dimethyl-2-methylidene-3,13-diphenylhexadecane-1,8-diol |
| SMILES | C=C(CO)C(C)(CCCCC(O)CCCCC(C)(CCC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H46O2/c1-5-22-30(3,27-16-8-6-9-17-27)23-14-12-20-29(33)21-13-15-24-31(4,26(2)25-32)28-18-10-7-11-19-28/h6-11,16-19,29,32-33H,2,5,12-15,20-25H2,1,3-4H3 |
| InChIKey | YAKSZERYGANDAB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|