C31H48O3 — CID 59660095
3,15-dimethyl-3,15-diphenylheptadecane-1,9,17-triol (PubChem CID 59660095) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is 3,15-dimethyl-3,15-diphenylheptadecane-1,9,17-triol.
| Compound Name | 3,15-dimethyl-3,15-diphenylheptadecane-1,9,17-triol |
|---|---|
| PubChem CID | 59660095 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | 3,15-dimethyl-3,15-diphenylheptadecane-1,9,17-triol |
| SMILES | CC(CCO)(CCCCCC(O)CCCCCC(C)(CCO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H48O3/c1-30(23-25-32,27-15-7-3-8-16-27)21-13-5-11-19-29(34)20-12-6-14-22-31(2,24-26-33)28-17-9-4-10-18-28/h3-4,7-10,15-18,29,32-34H,5-6,11-14,19-26H2,1-2H3 |
| InChIKey | YSYLEIRHLDVAGD-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|