C21H44O3 — CID 59660187
3,3,15,15-tetramethylheptadecane-1,9,17-triol (PubChem CID 59660187) has the molecular formula C21H44O3 and a molecular weight of 344.58 g/mol. Its IUPAC name is 3,3,15,15-tetramethylheptadecane-1,9,17-triol.
| Compound Name | 3,3,15,15-tetramethylheptadecane-1,9,17-triol |
|---|---|
| PubChem CID | 59660187 |
| Molecular Formula | C21H44O3 |
| Molecular Weight | 344.58 g/mol |
| Exact Mass | 344.33 |
| IUPAC Name | 3,3,15,15-tetramethylheptadecane-1,9,17-triol |
| SMILES | CC(C)(CCO)CCCCCC(O)CCCCCC(C)(C)CCO |
| InChI | InChI=1S/C21H44O3/c1-20(2,15-17-22)13-9-5-7-11-19(24)12-8-6-10-14-21(3,4)16-18-23/h19,22-24H,5-18H2,1-4H3 |
| InChIKey | RASJDZGBXMZABE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|