C16H34O4 — CID 88708863
10,13-dimethyltetradecane-1,3,10,13-tetrol (PubChem CID 88708863) has the molecular formula C16H34O4 and a molecular weight of 290.44 g/mol. Its IUPAC name is 10,13-dimethyltetradecane-1,3,10,13-tetrol.
| Compound Name | 10,13-dimethyltetradecane-1,3,10,13-tetrol |
|---|---|
| PubChem CID | 88708863 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 10,13-dimethyltetradecane-1,3,10,13-tetrol |
| SMILES | CC(C)(O)CCC(C)(O)CCCCCCC(O)CCO |
| InChI | InChI=1S/C16H34O4/c1-15(2,19)11-12-16(3,20)10-7-5-4-6-8-14(18)9-13-17/h14,17-20H,4-13H2,1-3H3 |
| InChIKey | LCGDAXBLCOZOHM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|