C14H30O3 — CID 90439782
8,11-dimethyldodecane-1,8,11-triol (PubChem CID 90439782) has the molecular formula C14H30O3 and a molecular weight of 246.39 g/mol. Its IUPAC name is 8,11-dimethyldodecane-1,8,11-triol.
| Compound Name | 8,11-dimethyldodecane-1,8,11-triol |
|---|---|
| PubChem CID | 90439782 |
| Molecular Formula | C14H30O3 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | 8,11-dimethyldodecane-1,8,11-triol |
| SMILES | CC(C)(O)CCC(C)(O)CCCCCCCO |
| InChI | InChI=1S/C14H30O3/c1-13(2,16)10-11-14(3,17)9-7-5-4-6-8-12-15/h15-17H,4-12H2,1-3H3 |
| InChIKey | JVWMMRMRZMVKNU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|