C21H42O3 — CID 66919588
14-[1-(methoxymethyl)cyclopropyl]-3,3-dimethyltetradecane-1,9-diol (PubChem CID 66919588) has the molecular formula C21H42O3 and a molecular weight of 342.56 g/mol. Its IUPAC name is 14-[1-(methoxymethyl)cyclopropyl]-3,3-dimethyltetradecane-1,9-diol.
| Compound Name | 14-[1-(methoxymethyl)cyclopropyl]-3,3-dimethyltetradecane-1,9-diol |
|---|---|
| PubChem CID | 66919588 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | 14-[1-(methoxymethyl)cyclopropyl]-3,3-dimethyltetradecane-1,9-diol |
| SMILES | COCC1(CCCCCC(O)CCCCCC(C)(C)CCO)CC1 |
| InChI | InChI=1S/C21H42O3/c1-20(2,16-17-22)12-8-4-6-10-19(23)11-7-5-9-13-21(14-15-21)18-24-3/h19,22-23H,4-18H2,1-3H3 |
| InChIKey | UYKUVMSNGZJCDF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|