C23H46O3 — CID 58097483
(9-hydroxy-3,3,15,15-tetramethyloctadecyl) formate (PubChem CID 58097483) has the molecular formula C23H46O3 and a molecular weight of 370.62 g/mol. Its IUPAC name is (9-hydroxy-3,3,15,15-tetramethyloctadecyl) formate.
| Compound Name | (9-hydroxy-3,3,15,15-tetramethyloctadecyl) formate |
|---|---|
| PubChem CID | 58097483 |
| Molecular Formula | C23H46O3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 370.34 |
| IUPAC Name | (9-hydroxy-3,3,15,15-tetramethyloctadecyl) formate |
| SMILES | CCCC(C)(C)CCCCCC(O)CCCCCC(C)(C)CCOC=O |
| InChI | InChI=1S/C23H46O3/c1-6-15-22(2,3)16-11-7-9-13-21(25)14-10-8-12-17-23(4,5)18-19-26-20-24/h20-21,25H,6-19H2,1-5H3 |
| InChIKey | IGYKSFJLDLYIOP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|