C28H54O5S2 — CID 174247069
(11-formyloxy-6-hydroxyundecyl) 2,2-bis(heptylsulfanyl)acetate (PubChem CID 174247069) has the molecular formula C28H54O5S2 and a molecular weight of 534.87 g/mol. Its IUPAC name is (11-formyloxy-6-hydroxyundecyl) 2,2-bis(heptylsulfanyl)acetate.
| Compound Name | (11-formyloxy-6-hydroxyundecyl) 2,2-bis(heptylsulfanyl)acetate |
|---|---|
| PubChem CID | 174247069 |
| Molecular Formula | C28H54O5S2 |
| Molecular Weight | 534.87 g/mol |
| Exact Mass | 534.34 |
| IUPAC Name | (11-formyloxy-6-hydroxyundecyl) 2,2-bis(heptylsulfanyl)acetate |
| SMILES | CCCCCCCSC(SCCCCCCC)C(=O)OCCCCCC(O)CCCCCOC=O |
| InChI | InChI=1S/C28H54O5S2/c1-3-5-7-9-17-23-34-28(35-24-18-10-8-6-4-2)27(31)33-22-16-12-14-20-26(30)19-13-11-15-21-32-25-29/h25-26,28,30H,3-24H2,1-2H3 |
| InChIKey | WYPGXVSBHNCBCE-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.87 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|