C29H42O3 — CID 23431379
1,15-dihydroxy-3,13-dimethyl-3,13-diphenylpentadecan-8-one (PubChem CID 23431379) has the molecular formula C29H42O3 and a molecular weight of 438.65 g/mol. Its IUPAC name is 1,15-dihydroxy-3,13-dimethyl-3,13-diphenylpentadecan-8-one.
| Compound Name | 1,15-dihydroxy-3,13-dimethyl-3,13-diphenylpentadecan-8-one |
|---|---|
| PubChem CID | 23431379 |
| Molecular Formula | C29H42O3 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 1,15-dihydroxy-3,13-dimethyl-3,13-diphenylpentadecan-8-one |
| SMILES | CC(CCO)(CCCCC(=O)CCCCC(C)(CCO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H42O3/c1-28(21-23-30,25-13-5-3-6-14-25)19-11-9-17-27(32)18-10-12-20-29(2,22-24-31)26-15-7-4-8-16-26/h3-8,13-16,30-31H,9-12,17-24H2,1-2H3 |
| InChIKey | WQZFKRMMENMXFV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|