C29H38O5 — CID 142135678
2,12-dimethyl-2,12-bis(2-methylphenyl)-7-oxotridecanedioic acid (PubChem CID 142135678) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is 2,12-dimethyl-2,12-bis(2-methylphenyl)-7-oxotridecanedioic acid.
| Compound Name | 2,12-dimethyl-2,12-bis(2-methylphenyl)-7-oxotridecanedioic acid |
|---|---|
| PubChem CID | 142135678 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2,12-dimethyl-2,12-bis(2-methylphenyl)-7-oxotridecanedioic acid |
| SMILES | Cc1ccccc1C(C)(CCCCC(=O)CCCCC(C)(C(=O)O)c1ccccc1C)C(=O)O |
| InChI | InChI=1S/C29H38O5/c1-21-13-5-7-17-24(21)28(3,26(31)32)19-11-9-15-23(30)16-10-12-20-29(4,27(33)34)25-18-8-6-14-22(25)2/h5-8,13-14,17-18H,9-12,15-16,19-20H2,1-4H3,(H,31,32)(H,33,34) |
| InChIKey | UPAGHPUAPRUUKL-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|