C29H34O5 — CID 20631100
3,11-dimethyl-2,12-dimethylidene-7-oxo-3,11-diphenyltridecanedioic acid (PubChem CID 20631100) has the molecular formula C29H34O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is 3,11-dimethyl-2,12-dimethylidene-7-oxo-3,11-diphenyltridecanedioic acid.
| Compound Name | 3,11-dimethyl-2,12-dimethylidene-7-oxo-3,11-diphenyltridecanedioic acid |
|---|---|
| PubChem CID | 20631100 |
| Molecular Formula | C29H34O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3,11-dimethyl-2,12-dimethylidene-7-oxo-3,11-diphenyltridecanedioic acid |
| SMILES | C=C(C(=O)O)C(C)(CCCC(=O)CCCC(C)(C(=C)C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34O5/c1-21(26(31)32)28(3,23-13-7-5-8-14-23)19-11-17-25(30)18-12-20-29(4,22(2)27(33)34)24-15-9-6-10-16-24/h5-10,13-16H,1-2,11-12,17-20H2,3-4H3,(H,31,32)(H,33,34) |
| InChIKey | DMTCJGLFSQSEGV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|