C30H44O4 — CID 161045446
15-hydroxy-2,14-dimethyl-8-oxo-2,14-diphenylpentadecanoic acid;methane (PubChem CID 161045446) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is 15-hydroxy-2,14-dimethyl-8-oxo-2,14-diphenylpentadecanoic acid;methane.
| Compound Name | 15-hydroxy-2,14-dimethyl-8-oxo-2,14-diphenylpentadecanoic acid;methane |
|---|---|
| PubChem CID | 161045446 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 15-hydroxy-2,14-dimethyl-8-oxo-2,14-diphenylpentadecanoic acid;methane |
| SMILES | C.CC(CO)(CCCCCC(=O)CCCCCC(C)(C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H40O4.CH4/c1-28(23-30,24-15-7-3-8-16-24)21-13-5-11-19-26(31)20-12-6-14-22-29(2,27(32)33)25-17-9-4-10-18-25;/h3-4,7-10,15-18,30H,5-6,11-14,19-23H2,1-2H3,(H,32,33);1H4 |
| InChIKey | UBLCGZUXQIHBFU-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|