C31H42O4 — CID 137383362
(Z)-2,16-dimethyl-2,16-diphenylheptadec-8-enedioic acid (PubChem CID 137383362) has the molecular formula C31H42O4 and a molecular weight of 478.67 g/mol. Its IUPAC name is (Z)-2,16-dimethyl-2,16-diphenylheptadec-8-enedioic acid.
| Compound Name | (Z)-2,16-dimethyl-2,16-diphenylheptadec-8-enedioic acid |
|---|---|
| PubChem CID | 137383362 |
| Molecular Formula | C31H42O4 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | (Z)-2,16-dimethyl-2,16-diphenylheptadec-8-enedioic acid |
| SMILES | CC(CCCCC/C=C\CCCCCCC(C)(C(=O)O)c1ccccc1)(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C31H42O4/c1-30(28(32)33,26-20-14-12-15-21-26)24-18-10-8-6-4-3-5-7-9-11-19-25-31(2,29(34)35)27-22-16-13-17-23-27/h3-4,12-17,20-23H,5-11,18-19,24-25H2,1-2H3,(H,32,33)(H,34,35)/b4-3- |
| InChIKey | QLQUEGTUJXMCLW-ARJAWSKDSA-N |
| XLogP | 7.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|