C29H44O4S — CID 143048137
6-(5-carboxy-5-phenylhexyl)sulfanyl-2,2-dimethylhexanoic acid;(2Z,4Z,6Z)-octa-2,4,6-triene (PubChem CID 143048137) has the molecular formula C29H44O4S and a molecular weight of 488.73 g/mol. Its IUPAC name is 6-(5-carboxy-5-phenylhexyl)sulfanyl-2,2-dimethylhexanoic acid;(2Z,4Z,6Z)-octa-2,4,6-triene.
| Compound Name | 6-(5-carboxy-5-phenylhexyl)sulfanyl-2,2-dimethylhexanoic acid;(2Z,4Z,6Z)-octa-2,4,6-triene |
|---|---|
| PubChem CID | 143048137 |
| Molecular Formula | C29H44O4S |
| Molecular Weight | 488.73 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | 6-(5-carboxy-5-phenylhexyl)sulfanyl-2,2-dimethylhexanoic acid;(2Z,4Z,6Z)-octa-2,4,6-triene |
| SMILES | C/C=C\C=C/C=C\C.CC(C)(CCCCSCCCCC(C)(C(=O)O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H32O4S.C8H12/c1-20(2,18(22)23)13-7-9-15-26-16-10-8-14-21(3,19(24)25)17-11-5-4-6-12-17;1-3-5-7-8-6-4-2/h4-6,11-12H,7-10,13-16H2,1-3H3,(H,22,23)(H,24,25);3-8H,1-2H3/b;5-3-,6-4-,8-7- |
| InChIKey | SGHIIGFNXIGCHA-LOBDRIMYSA-N |
| XLogP | 7.91 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.73 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|