C21H32O4S2 — CID 141186655
4-[3-(3,3-dimethyl-4-oxo-4-phenoxybutyl)sulfanylpropylsulfanyl]-2,2-dimethylbutanoic acid (PubChem CID 141186655) has the molecular formula C21H32O4S2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 4-[3-(3,3-dimethyl-4-oxo-4-phenoxybutyl)sulfanylpropylsulfanyl]-2,2-dimethylbutanoic acid.
| Compound Name | 4-[3-(3,3-dimethyl-4-oxo-4-phenoxybutyl)sulfanylpropylsulfanyl]-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 141186655 |
| Molecular Formula | C21H32O4S2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-[3-(3,3-dimethyl-4-oxo-4-phenoxybutyl)sulfanylpropylsulfanyl]-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CCSCCCSCCC(C)(C)C(=O)Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H32O4S2/c1-20(2,18(22)23)11-15-26-13-8-14-27-16-12-21(3,4)19(24)25-17-9-6-5-7-10-17/h5-7,9-10H,8,11-16H2,1-4H3,(H,22,23) |
| InChIKey | WOVIGYAIXVAMAT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|