C27H36N2O4S — CID 11271673
phenyl 5-[(4,4-dimethyl-5-oxo-5-phenoxypentyl)carbamothioylamino]-2,2-dimethylpentanoate (PubChem CID 11271673) has the molecular formula C27H36N2O4S and a molecular weight of 484.66 g/mol. Its IUPAC name is phenyl 5-[(4,4-dimethyl-5-oxo-5-phenoxypentyl)carbamothioylamino]-2,2-dimethylpentanoate.
| Compound Name | phenyl 5-[(4,4-dimethyl-5-oxo-5-phenoxypentyl)carbamothioylamino]-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 11271673 |
| Molecular Formula | C27H36N2O4S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | phenyl 5-[(4,4-dimethyl-5-oxo-5-phenoxypentyl)carbamothioylamino]-2,2-dimethylpentanoate |
| SMILES | CC(C)(CCCNC(=S)NCCCC(C)(C)C(=O)Oc1ccccc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C27H36N2O4S/c1-26(2,23(30)32-21-13-7-5-8-14-21)17-11-19-28-25(34)29-20-12-18-27(3,4)24(31)33-22-15-9-6-10-16-22/h5-10,13-16H,11-12,17-20H2,1-4H3,(H2,28,29,34) |
| InChIKey | IYDZLAPBASHYCS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|