C58H88O9 — CID 91144765
benzyl 8-hydroxy-2,2,14,14-tetramethyl-15-oxohexadecanoate;diphenyl 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate (PubChem CID 91144765) has the molecular formula C58H88O9 and a molecular weight of 929.33 g/mol. Its IUPAC name is benzyl 8-hydroxy-2,2,14,14-tetramethyl-15-oxohexadecanoate;diphenyl 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate.
| Compound Name | benzyl 8-hydroxy-2,2,14,14-tetramethyl-15-oxohexadecanoate;diphenyl 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate |
|---|---|
| PubChem CID | 91144765 |
| Molecular Formula | C58H88O9 |
| Molecular Weight | 929.33 g/mol |
| Exact Mass | 928.64 |
| IUPAC Name | benzyl 8-hydroxy-2,2,14,14-tetramethyl-15-oxohexadecanoate;diphenyl 8-hydroxy-2,2,14,14-tetramethylpentadecanedioate |
| SMILES | CC(=O)C(C)(C)CCCCCC(O)CCCCCC(C)(C)C(=O)OCc1ccccc1.CC(C)(CCCCCC(O)CCCCCC(C)(C)C(=O)Oc1ccccc1)C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C31H44O5.C27H44O4/c1-30(2,28(33)35-26-19-11-5-12-20-26)23-15-7-9-17-25(32)18-10-8-16-24-31(3,4)29(34)36-27-21-13-6-14-22-27;1-22(28)26(2,3)19-13-7-11-17-24(29)18-12-8-14-20-27(4,5)25(30)31-21-23-15-9-6-10-16-23/h5-6,11-14,19-22,25,32H,7-10,15-18,23-24H2,1-4H3;6,9-10,15-16,24,29H,7-8,11-14,17-21H2,1-5H3 |
| InChIKey | YPTNPGYGPIOYOX-UHFFFAOYSA-N |
| XLogP | 14.15 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.33 |
| LogP ≤ 5 | 14.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|