C24H38N2O4S — CID 87985214
6-[(5,5-dimethyl-6-oxo-6-phenylmethoxyhexyl)carbamothioylamino]-2,2-dimethylhexanoic acid (PubChem CID 87985214) has the molecular formula C24H38N2O4S and a molecular weight of 450.65 g/mol. Its IUPAC name is 6-[(5,5-dimethyl-6-oxo-6-phenylmethoxyhexyl)carbamothioylamino]-2,2-dimethylhexanoic acid.
| Compound Name | 6-[(5,5-dimethyl-6-oxo-6-phenylmethoxyhexyl)carbamothioylamino]-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 87985214 |
| Molecular Formula | C24H38N2O4S |
| Molecular Weight | 450.65 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 6-[(5,5-dimethyl-6-oxo-6-phenylmethoxyhexyl)carbamothioylamino]-2,2-dimethylhexanoic acid |
| SMILES | CC(C)(CCCCNC(=S)NCCCCC(C)(C)C(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H38N2O4S/c1-23(2,20(27)28)14-8-10-16-25-22(31)26-17-11-9-15-24(3,4)21(29)30-18-19-12-6-5-7-13-19/h5-7,12-13H,8-11,14-18H2,1-4H3,(H,27,28)(H2,25,26,31) |
| InChIKey | CXLZNUUYOARKED-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|