C32H46O6S2 — CID 70011942
benzyl 6-[3-(4,4-dimethyl-5-oxo-5-phenylmethoxypentyl)sulfinylpropylsulfinyl]-2,2-dimethylhexanoate (PubChem CID 70011942) has the molecular formula C32H46O6S2 and a molecular weight of 590.85 g/mol. Its IUPAC name is benzyl 6-[3-(4,4-dimethyl-5-oxo-5-phenylmethoxypentyl)sulfinylpropylsulfinyl]-2,2-dimethylhexanoate.
| Compound Name | benzyl 6-[3-(4,4-dimethyl-5-oxo-5-phenylmethoxypentyl)sulfinylpropylsulfinyl]-2,2-dimethylhexanoate |
|---|---|
| PubChem CID | 70011942 |
| Molecular Formula | C32H46O6S2 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | benzyl 6-[3-(4,4-dimethyl-5-oxo-5-phenylmethoxypentyl)sulfinylpropylsulfinyl]-2,2-dimethylhexanoate |
| SMILES | CC(C)(CCCCS(=O)CCCS(=O)CCCC(C)(C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C32H46O6S2/c1-31(2,29(33)37-25-27-15-7-5-8-16-27)19-11-12-21-39(35)23-14-24-40(36)22-13-20-32(3,4)30(34)38-26-28-17-9-6-10-18-28/h5-10,15-18H,11-14,19-26H2,1-4H3 |
| InChIKey | ZWBVAZUJPGBGJP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|