C31H40O6 — CID 10185803
dibenzyl 2,2,12,12-tetramethyl-5,9-dioxotridecanedioate (PubChem CID 10185803) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is dibenzyl 2,2,12,12-tetramethyl-5,9-dioxotridecanedioate.
| Compound Name | dibenzyl 2,2,12,12-tetramethyl-5,9-dioxotridecanedioate |
|---|---|
| PubChem CID | 10185803 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | dibenzyl 2,2,12,12-tetramethyl-5,9-dioxotridecanedioate |
| SMILES | CC(C)(CCC(=O)CCCC(=O)CCC(C)(C)C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H40O6/c1-30(2,28(34)36-22-24-12-7-5-8-13-24)20-18-26(32)16-11-17-27(33)19-21-31(3,4)29(35)37-23-25-14-9-6-10-15-25/h5-10,12-15H,11,16-23H2,1-4H3 |
| InChIKey | KNBORSPHBSZAMJ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |