C15H21NO4 — CID 143527761
phenyl 5-(hydroxyamino)-2,2,4,4-tetramethyl-5-oxopentanoate (PubChem CID 143527761) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is phenyl 5-(hydroxyamino)-2,2,4,4-tetramethyl-5-oxopentanoate.
| Compound Name | phenyl 5-(hydroxyamino)-2,2,4,4-tetramethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 143527761 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | phenyl 5-(hydroxyamino)-2,2,4,4-tetramethyl-5-oxopentanoate |
| SMILES | CC(C)(CC(C)(C)C(=O)Oc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C15H21NO4/c1-14(2,12(17)16-19)10-15(3,4)13(18)20-11-8-6-5-7-9-11/h5-9,19H,10H2,1-4H3,(H,16,17) |
| InChIKey | UXNPXXICVRKWBF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|