C10H19NO3 — CID 89136777
N-hydroxy-2,2,4,4-tetramethyl-5-oxohexanamide (PubChem CID 89136777) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-hydroxy-2,2,4,4-tetramethyl-5-oxohexanamide.
| Compound Name | N-hydroxy-2,2,4,4-tetramethyl-5-oxohexanamide |
|---|---|
| PubChem CID | 89136777 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-hydroxy-2,2,4,4-tetramethyl-5-oxohexanamide |
| SMILES | CC(=O)C(C)(C)CC(C)(C)C(=O)NO |
| InChI | InChI=1S/C10H19NO3/c1-7(12)9(2,3)6-10(4,5)8(13)11-14/h14H,6H2,1-5H3,(H,11,13) |
| InChIKey | DBUZATZQHMUOHB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|