C13H29NO — CID 144770471
ethane;3,3,5,5-tetramethyl-6-(methylamino)hexan-2-one (PubChem CID 144770471) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is ethane;3,3,5,5-tetramethyl-6-(methylamino)hexan-2-one.
| Compound Name | ethane;3,3,5,5-tetramethyl-6-(methylamino)hexan-2-one |
|---|---|
| PubChem CID | 144770471 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | ethane;3,3,5,5-tetramethyl-6-(methylamino)hexan-2-one |
| SMILES | CC.CNCC(C)(C)CC(C)(C)C(C)=O |
| InChI | InChI=1S/C11H23NO.C2H6/c1-9(13)11(4,5)7-10(2,3)8-12-6;1-2/h12H,7-8H2,1-6H3;1-2H3 |
| InChIKey | ALMVLCYVFUQSRU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |