About (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one
(5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one (PubChem CID 118120014) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one.
Molecular Properties
| Compound Name | (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one |
| PubChem CID | 118120014 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one |
| SMILES | CC[C@](C)(CC(C)(C)C(C)=O)NC |
| InChI | InChI=1S/C11H23NO/c1-7-11(5,12-6)8-10(3,4)9(2)13/h12H,7-8H2,1-6H3/t11-/m1/s1 |
| InChIKey | RLBMOCMYCMCKJA-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one?
The IUPAC name of (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one (CID 118120014) is (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one.
What is the SMILES notation for (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one?
The canonical SMILES for (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one is CC[C@](C)(CC(C)(C)C(C)=O)NC.
What is the InChIKey of (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one?
The InChIKey is RLBMOCMYCMCKJA-LLVKDONJSA-N. The full InChI is InChI=1S/C11H23NO/c1-7-11(5,12-6)8-10(3,4)9(2)13/h12H,7-8H2,1-6H3/t11-/m1/s1.
What are the key properties of (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one?
(5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one has a molecular weight of 185.31 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3,3,5-trimethyl-5-(methylamino)heptan-2-one is sourced from PubChem (CID 118120014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).