C12H23NO3 — CID 166130930
N-(2-hydroxyethyl)-2,2,4,4-tetramethyl-5-oxohexanamide (PubChem CID 166130930) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2,2,4,4-tetramethyl-5-oxohexanamide.
| Compound Name | N-(2-hydroxyethyl)-2,2,4,4-tetramethyl-5-oxohexanamide |
|---|---|
| PubChem CID | 166130930 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | N-(2-hydroxyethyl)-2,2,4,4-tetramethyl-5-oxohexanamide |
| SMILES | CC(=O)C(C)(C)CC(C)(C)C(=O)NCCO |
| InChI | InChI=1S/C12H23NO3/c1-9(15)11(2,3)8-12(4,5)10(16)13-6-7-14/h14H,6-8H2,1-5H3,(H,13,16) |
| InChIKey | SUDCLASTFSXFOM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |