C12H25NO — CID 164974261
3,3,5-trimethyl-5-(propan-2-ylamino)hexan-2-one (PubChem CID 164974261) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 3,3,5-trimethyl-5-(propan-2-ylamino)hexan-2-one.
| Compound Name | 3,3,5-trimethyl-5-(propan-2-ylamino)hexan-2-one |
|---|---|
| PubChem CID | 164974261 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 3,3,5-trimethyl-5-(propan-2-ylamino)hexan-2-one |
| SMILES | CC(=O)C(C)(C)CC(C)(C)NC(C)C |
| InChI | InChI=1S/C12H25NO/c1-9(2)13-12(6,7)8-11(4,5)10(3)14/h9,13H,8H2,1-7H3 |
| InChIKey | DOBAHZHGTZBJNY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |