C16H32N2O2 — CID 177178703
N-(2-but-3-en-2-yloxyethyl)-2,2,4,4-tetramethyl-5-(methylamino)pentanamide (PubChem CID 177178703) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is N-(2-but-3-en-2-yloxyethyl)-2,2,4,4-tetramethyl-5-(methylamino)pentanamide.
| Compound Name | N-(2-but-3-en-2-yloxyethyl)-2,2,4,4-tetramethyl-5-(methylamino)pentanamide |
|---|---|
| PubChem CID | 177178703 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | N-(2-but-3-en-2-yloxyethyl)-2,2,4,4-tetramethyl-5-(methylamino)pentanamide |
| SMILES | C=CC(C)OCCNC(=O)C(C)(C)CC(C)(C)CNC |
| InChI | InChI=1S/C16H32N2O2/c1-8-13(2)20-10-9-18-14(19)16(5,6)11-15(3,4)12-17-7/h8,13,17H,1,9-12H2,2-7H3,(H,18,19) |
| InChIKey | LWORQYKNQMAUNH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|