C13H23NO4 — CID 170223606
2-[2-(2,2-dimethylbutanoylamino)ethoxy]ethyl prop-2-enoate (PubChem CID 170223606) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[2-(2,2-dimethylbutanoylamino)ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(2,2-dimethylbutanoylamino)ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 170223606 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-[2-(2,2-dimethylbutanoylamino)ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCNC(=O)C(C)(C)CC |
| InChI | InChI=1S/C13H23NO4/c1-5-11(15)18-10-9-17-8-7-14-12(16)13(3,4)6-2/h5H,1,6-10H2,2-4H3,(H,14,16) |
| InChIKey | DURLLFMYFXPFSM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|