C28H42N4O12 — CID 59460229
[2-methyl-2-[2-[2-[2-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoylamino]ethoxy]ethoxy]ethylcarbamoylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 59460229) has the molecular formula C28H42N4O12 and a molecular weight of 626.66 g/mol. Its IUPAC name is [2-methyl-2-[2-[2-[2-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoylamino]ethoxy]ethoxy]ethylcarbamoylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-methyl-2-[2-[2-[2-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoylamino]ethoxy]ethoxy]ethylcarbamoylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 59460229 |
| Molecular Formula | C28H42N4O12 |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | [2-methyl-2-[2-[2-[2-[[2-methyl-1,3-di(prop-2-enoyloxy)propan-2-yl]carbamoylamino]ethoxy]ethoxy]ethylcarbamoylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)NCCOCCOCCNC(=O)NC(C)(COC(=O)C=C)COC(=O)C=C |
| InChI | InChI=1S/C28H42N4O12/c1-7-21(33)41-17-27(5,18-42-22(34)8-2)31-25(37)29-11-13-39-15-16-40-14-12-30-26(38)32-28(6,19-43-23(35)9-3)20-44-24(36)10-4/h7-10H,1-4,11-20H2,5-6H3,(H2,29,31,37)(H2,30,32,38) |
| InChIKey | UOMNSTLXKHOIQJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 205.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|