C20H33N3O6 — CID 88566153
[2-[3-(2,2-dimethylbutanoylamino)propylcarbamoylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 88566153) has the molecular formula C20H33N3O6 and a molecular weight of 411.50 g/mol. Its IUPAC name is [2-[3-(2,2-dimethylbutanoylamino)propylcarbamoylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[3-(2,2-dimethylbutanoylamino)propylcarbamoylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 88566153 |
| Molecular Formula | C20H33N3O6 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | [2-[3-(2,2-dimethylbutanoylamino)propylcarbamoylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)NCCCNC(=O)C(C)(C)CC |
| InChI | InChI=1S/C20H33N3O6/c1-7-15(24)28-13-20(6,14-29-16(25)8-2)23-18(27)22-12-10-11-21-17(26)19(4,5)9-3/h7-8H,1-2,9-14H2,3-6H3,(H,21,26)(H2,22,23,27) |
| InChIKey | AXFHFKVVXCRAKN-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|