C10H18N2O5 — CID 144910587
2-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoylamino]ethyl prop-2-enoate (PubChem CID 144910587) has the molecular formula C10H18N2O5 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoylamino]ethyl prop-2-enoate.
| Compound Name | 2-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 144910587 |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 2-[(1,3-dihydroxy-2-methylpropan-2-yl)carbamoylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)NC(C)(CO)CO |
| InChI | InChI=1S/C10H18N2O5/c1-3-8(15)17-5-4-11-9(16)12-10(2,6-13)7-14/h3,13-14H,1,4-7H2,2H3,(H2,11,12,16) |
| InChIKey | XFKOZLXEQUROHV-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|