About 2-acetamidoethyl prop-2-enoate;ethane
2-acetamidoethyl prop-2-enoate;ethane (PubChem CID 158515563) has the molecular formula C29H77NO3
and a molecular weight of 487.94 g/mol. Its IUPAC name is 2-acetamidoethyl prop-2-enoate;ethane.
Molecular Properties
| Compound Name | 2-acetamidoethyl prop-2-enoate;ethane |
| PubChem CID | 158515563 |
| Molecular Formula | C29H77NO3 |
| Molecular Weight | 487.94 g/mol |
| Exact Mass | 487.59 |
| IUPAC Name | 2-acetamidoethyl prop-2-enoate;ethane |
| SMILES | C=CC(=O)OCCNC(C)=O.CC.CC.CC.CC.CC.CC.CC.CC.CC.CC.CC |
| InChI | InChI=1S/C7H11NO3.11C2H6/c1-3-7(10)11-5-4-8-6(2)9;11*1-2/h3H,1,4-5H2,2H3,(H,8,9);11*1-2H3 |
| InChIKey | HLOVHYYAJDBDJX-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.94 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidoethyl prop-2-enoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoethyl prop-2-enoate;ethane?
The IUPAC name of 2-acetamidoethyl prop-2-enoate;ethane (CID 158515563) is 2-acetamidoethyl prop-2-enoate;ethane.
What is the SMILES notation for 2-acetamidoethyl prop-2-enoate;ethane?
The canonical SMILES for 2-acetamidoethyl prop-2-enoate;ethane is C=CC(=O)OCCNC(C)=O.CC.CC.CC.CC.CC.CC.CC.CC.CC.CC.CC.
What is the InChIKey of 2-acetamidoethyl prop-2-enoate;ethane?
The InChIKey is HLOVHYYAJDBDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3.11C2H6/c1-3-7(10)11-5-4-8-6(2)9;11*1-2/h3H,1,4-5H2,2H3,(H,8,9);11*1-2H3.
What are the key properties of 2-acetamidoethyl prop-2-enoate;ethane?
2-acetamidoethyl prop-2-enoate;ethane has a molecular weight of 487.94 g/mol, XLogP of 11.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoethyl prop-2-enoate;ethane is sourced from PubChem (CID 158515563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).