About 2-acetamidoethyl hydrogen carbonate
2-acetamidoethyl hydrogen carbonate (PubChem CID 150133482) has the molecular formula C5H9NO4
and a molecular weight of 147.13 g/mol. Its IUPAC name is 2-acetamidoethyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-acetamidoethyl hydrogen carbonate |
| PubChem CID | 150133482 |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 2-acetamidoethyl hydrogen carbonate |
| SMILES | CC(=O)NCCOC(=O)O |
| InChI | InChI=1S/C5H9NO4/c1-4(7)6-2-3-10-5(8)9/h2-3H2,1H3,(H,6,7)(H,8,9) |
| InChIKey | FBSXRSRBKUIKIP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidoethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoethyl hydrogen carbonate?
The IUPAC name of 2-acetamidoethyl hydrogen carbonate (CID 150133482) is 2-acetamidoethyl hydrogen carbonate.
What is the SMILES notation for 2-acetamidoethyl hydrogen carbonate?
The canonical SMILES for 2-acetamidoethyl hydrogen carbonate is CC(=O)NCCOC(=O)O.
What is the InChIKey of 2-acetamidoethyl hydrogen carbonate?
The InChIKey is FBSXRSRBKUIKIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4/c1-4(7)6-2-3-10-5(8)9/h2-3H2,1H3,(H,6,7)(H,8,9).
What are the key properties of 2-acetamidoethyl hydrogen carbonate?
2-acetamidoethyl hydrogen carbonate has a molecular weight of 147.13 g/mol, XLogP of -0.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoethyl hydrogen carbonate is sourced from PubChem (CID 150133482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).