About 2-acetamidoethyl propanoate
2-acetamidoethyl propanoate (PubChem CID 54208768) has the molecular formula C7H13NO3
and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-acetamidoethyl propanoate.
Molecular Properties
| Compound Name | 2-acetamidoethyl propanoate |
| PubChem CID | 54208768 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 2-acetamidoethyl propanoate |
| SMILES | CCC(=O)OCCNC(C)=O |
| InChI | InChI=1S/C7H13NO3/c1-3-7(10)11-5-4-8-6(2)9/h3-5H2,1-2H3,(H,8,9) |
| InChIKey | IDJOJQKDFLHLDQ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidoethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoethyl propanoate?
The IUPAC name of 2-acetamidoethyl propanoate (CID 54208768) is 2-acetamidoethyl propanoate.
What is the SMILES notation for 2-acetamidoethyl propanoate?
The canonical SMILES for 2-acetamidoethyl propanoate is CCC(=O)OCCNC(C)=O.
What is the InChIKey of 2-acetamidoethyl propanoate?
The InChIKey is IDJOJQKDFLHLDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3/c1-3-7(10)11-5-4-8-6(2)9/h3-5H2,1-2H3,(H,8,9).
What are the key properties of 2-acetamidoethyl propanoate?
2-acetamidoethyl propanoate has a molecular weight of 159.19 g/mol, XLogP of 0.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoethyl propanoate is sourced from PubChem (CID 54208768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).