About 2-acetamidoethyl 1-chloroethyl carbonate
2-acetamidoethyl 1-chloroethyl carbonate (PubChem CID 23019510) has the molecular formula C7H12ClNO4
and a molecular weight of 209.63 g/mol. Its IUPAC name is 2-acetamidoethyl 1-chloroethyl carbonate.
Molecular Properties
| Compound Name | 2-acetamidoethyl 1-chloroethyl carbonate |
| PubChem CID | 23019510 |
| Molecular Formula | C7H12ClNO4 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-acetamidoethyl 1-chloroethyl carbonate |
| SMILES | CC(=O)NCCOC(=O)OC(C)Cl |
| InChI | InChI=1S/C7H12ClNO4/c1-5(8)13-7(11)12-4-3-9-6(2)10/h5H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | UGXIMGKBVFGTMB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamidoethyl 1-chloroethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidoethyl 1-chloroethyl carbonate?
The IUPAC name of 2-acetamidoethyl 1-chloroethyl carbonate (CID 23019510) is 2-acetamidoethyl 1-chloroethyl carbonate.
What is the SMILES notation for 2-acetamidoethyl 1-chloroethyl carbonate?
The canonical SMILES for 2-acetamidoethyl 1-chloroethyl carbonate is CC(=O)NCCOC(=O)OC(C)Cl.
What is the InChIKey of 2-acetamidoethyl 1-chloroethyl carbonate?
The InChIKey is UGXIMGKBVFGTMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO4/c1-5(8)13-7(11)12-4-3-9-6(2)10/h5H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 2-acetamidoethyl 1-chloroethyl carbonate?
2-acetamidoethyl 1-chloroethyl carbonate has a molecular weight of 209.63 g/mol, XLogP of 0.86, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidoethyl 1-chloroethyl carbonate is sourced from PubChem (CID 23019510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).