About [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate
[(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate (PubChem CID 129387102) has the molecular formula C10H19ClO6
and a molecular weight of 270.71 g/mol. Its IUPAC name is [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate.
Molecular Properties
| Compound Name | [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate |
| PubChem CID | 129387102 |
| Molecular Formula | C10H19ClO6 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate |
| SMILES | COCCOCCOCCOC(=O)O[C@@H](C)Cl |
| InChI | InChI=1S/C10H19ClO6/c1-9(11)17-10(12)16-8-7-15-6-5-14-4-3-13-2/h9H,3-8H2,1-2H3/t9-/m0/s1 |
| InChIKey | YAGDSHLJRXKUHH-VIFPVBQESA-N |
| XLogP | 1.40 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate?
The IUPAC name of [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate (CID 129387102) is [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate.
What is the SMILES notation for [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate?
The canonical SMILES for [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate is COCCOCCOCCOC(=O)O[C@@H](C)Cl.
What is the InChIKey of [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate?
The InChIKey is YAGDSHLJRXKUHH-VIFPVBQESA-N. The full InChI is InChI=1S/C10H19ClO6/c1-9(11)17-10(12)16-8-7-15-6-5-14-4-3-13-2/h9H,3-8H2,1-2H3/t9-/m0/s1.
What are the key properties of [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate?
[(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate has a molecular weight of 270.71 g/mol, XLogP of 1.40, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-chloroethyl] 2-[2-(2-methoxyethoxy)ethoxy]ethyl carbonate is sourced from PubChem (CID 129387102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).