About 4-(2-methoxyethoxy)butyl methyl carbonate
4-(2-methoxyethoxy)butyl methyl carbonate (PubChem CID 87247594) has the molecular formula C9H18O5
and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)butyl methyl carbonate.
Molecular Properties
| Compound Name | 4-(2-methoxyethoxy)butyl methyl carbonate |
| PubChem CID | 87247594 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 4-(2-methoxyethoxy)butyl methyl carbonate |
| SMILES | COCCOCCCCOC(=O)OC |
| InChI | InChI=1S/C9H18O5/c1-11-7-8-13-5-3-4-6-14-9(10)12-2/h3-8H2,1-2H3 |
| InChIKey | XFYGLEWIZQWDJF-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methoxyethoxy)butyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methoxyethoxy)butyl methyl carbonate?
The IUPAC name of 4-(2-methoxyethoxy)butyl methyl carbonate (CID 87247594) is 4-(2-methoxyethoxy)butyl methyl carbonate.
What is the SMILES notation for 4-(2-methoxyethoxy)butyl methyl carbonate?
The canonical SMILES for 4-(2-methoxyethoxy)butyl methyl carbonate is COCCOCCCCOC(=O)OC.
What is the InChIKey of 4-(2-methoxyethoxy)butyl methyl carbonate?
The InChIKey is XFYGLEWIZQWDJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O5/c1-11-7-8-13-5-3-4-6-14-9(10)12-2/h3-8H2,1-2H3.
What are the key properties of 4-(2-methoxyethoxy)butyl methyl carbonate?
4-(2-methoxyethoxy)butyl methyl carbonate has a molecular weight of 206.24 g/mol, XLogP of 1.21, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methoxyethoxy)butyl methyl carbonate is sourced from PubChem (CID 87247594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).