About 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate
5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate (PubChem CID 91693764) has the molecular formula C13H24O8
and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate.
Molecular Properties
| Compound Name | 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate |
| PubChem CID | 91693764 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCCCCCOC(=O)OCCOC |
| InChI | InChI=1S/C13H24O8/c1-16-8-10-20-12(14)18-6-4-3-5-7-19-13(15)21-11-9-17-2/h3-11H2,1-2H3 |
| InChIKey | OBAAJQGTEZPQKS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate?
The IUPAC name of 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate (CID 91693764) is 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate.
What is the SMILES notation for 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate?
The canonical SMILES for 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate is COCCOC(=O)OCCCCCOC(=O)OCCOC.
What is the InChIKey of 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate?
The InChIKey is OBAAJQGTEZPQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O8/c1-16-8-10-20-12(14)18-6-4-3-5-7-19-13(15)21-11-9-17-2/h3-11H2,1-2H3.
What are the key properties of 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate?
5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate has a molecular weight of 308.33 g/mol, XLogP of 1.76, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methoxyethoxycarbonyloxy)pentyl 2-methoxyethyl carbonate is sourced from PubChem (CID 91693764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).