About azane;methyl tetradecyl carbonate
azane;methyl tetradecyl carbonate (PubChem CID 118914581) has the molecular formula C16H35NO3
and a molecular weight of 289.46 g/mol. Its IUPAC name is azane;methyl tetradecyl carbonate.
Molecular Properties
| Compound Name | azane;methyl tetradecyl carbonate |
| PubChem CID | 118914581 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | azane;methyl tetradecyl carbonate |
| SMILES | CCCCCCCCCCCCCCOC(=O)OC.N |
| InChI | InChI=1S/C16H32O3.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16(17)18-2;/h3-15H2,1-2H3;1H3 |
| InChIKey | ULSDURLWFLMRRK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 70.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl tetradecyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl tetradecyl carbonate?
The IUPAC name of azane;methyl tetradecyl carbonate (CID 118914581) is azane;methyl tetradecyl carbonate.
What is the SMILES notation for azane;methyl tetradecyl carbonate?
The canonical SMILES for azane;methyl tetradecyl carbonate is CCCCCCCCCCCCCCOC(=O)OC.N.
What is the InChIKey of azane;methyl tetradecyl carbonate?
The InChIKey is ULSDURLWFLMRRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16(17)18-2;/h3-15H2,1-2H3;1H3.
What are the key properties of azane;methyl tetradecyl carbonate?
azane;methyl tetradecyl carbonate has a molecular weight of 289.46 g/mol, XLogP of 5.63, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl tetradecyl carbonate is sourced from PubChem (CID 118914581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).