C11H22O7 — CID 58205614
2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-hydroxy-2-(hydroxymethyl)propanoate (PubChem CID 58205614) has the molecular formula C11H22O7 and a molecular weight of 266.29 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-hydroxy-2-(hydroxymethyl)propanoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-hydroxy-2-(hydroxymethyl)propanoate |
|---|---|
| PubChem CID | 58205614 |
| Molecular Formula | C11H22O7 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 3-hydroxy-2-(hydroxymethyl)propanoate |
| SMILES | COCCOCCOCCOC(=O)C(CO)CO |
| InChI | InChI=1S/C11H22O7/c1-15-2-3-16-4-5-17-6-7-18-11(14)10(8-12)9-13/h10,12-13H,2-9H2,1H3 |
| InChIKey | IMYQEHNDHJJUDU-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|