About 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate
2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate (PubChem CID 103178431) has the molecular formula C11H23NO4
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate.
Molecular Properties
| Compound Name | 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate |
| PubChem CID | 103178431 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate |
| SMILES | CCC(CN)C(=O)OCCOCCCOC |
| InChI | InChI=1S/C11H23NO4/c1-3-10(9-12)11(13)16-8-7-15-6-4-5-14-2/h10H,3-9,12H2,1-2H3 |
| InChIKey | LNVWAYYIZOBBPH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate?
The IUPAC name of 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate (CID 103178431) is 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate.
What is the SMILES notation for 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate?
The canonical SMILES for 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate is CCC(CN)C(=O)OCCOCCCOC.
What is the InChIKey of 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate?
The InChIKey is LNVWAYYIZOBBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO4/c1-3-10(9-12)11(13)16-8-7-15-6-4-5-14-2/h10H,3-9,12H2,1-2H3.
What are the key properties of 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate?
2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate has a molecular weight of 233.31 g/mol, XLogP of 0.57, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxypropoxy)ethyl 2-(aminomethyl)butanoate is sourced from PubChem (CID 103178431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).