C12H25NO4 — CID 103178228
2-(3-methoxypropoxy)ethyl (2S)-2-amino-3,3-dimethylbutanoate (PubChem CID 103178228) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is 2-(3-methoxypropoxy)ethyl (2S)-2-amino-3,3-dimethylbutanoate.
| Compound Name | 2-(3-methoxypropoxy)ethyl (2S)-2-amino-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 103178228 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 2-(3-methoxypropoxy)ethyl (2S)-2-amino-3,3-dimethylbutanoate |
| SMILES | COCCCOCCOC(=O)[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C12H25NO4/c1-12(2,3)10(13)11(14)17-9-8-16-7-5-6-15-4/h10H,5-9,13H2,1-4H3/t10-/m1/s1 |
| InChIKey | CHLCCSDRTJZRQL-SNVBAGLBSA-N |
| XLogP | 0.96 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|